Product
Catalog No.:RSN0010 | |
Product: Pyridoxal 5'-phosphate | |
CAS No. 853645-22-4 | |
Chemical Name: Pyridoxal 5'-phosphate | |
Molecular Formula: C8H10NO6P | |
Molecular Weight: 247.14 | |
Assay:98% | |
Appearance: White solid | |
SMILES:CC1=C(C(C=O)=C(C=N1)COP(O)(O)=O)O | |
Storage Condition:keep in dry place | |
Remark:Pyridoxal 5′-phosphate is used as a cofactor for a wide range of enzymes including mitochondrial cysteine desulfurase, cystathionine γ-synthase (CGS), ornithine 4,5-aminomutase (OAM), and d-serine dehydratase. | |