Product
Catalog No.:RSC0002 | |
Product: Ethyl Ascorbic Acid/Vitamin C ethyl ether | |
CAS No. 86404-04-8 | |
Chemical Name: 3-O-Ethyl-L-ascorbic acid | |
Molecular Formula: C8H12O6 | |
Molecular Weight: 204.18 | |
Assay:99% | |
Appearance: White powder | |
SMILES:O[C@@H](CO)[C@@H](O1)C(OCC)=C(O)C1=O | |
Storage Condition:Shielded form light and keep closed | |
Remark:Ethyl Ascorbic Acid is one kind of Vitamin C ramification. It can be used in whitening or anti-aging cosmetic such as gel,ssence,latex and creams. | |