 |
|
| Catalog No.:A1255 |
|
| Product: JNJ-10198409 |
|
| CAS No. 627518-40-5 |
|
| Chemical Name: N-(3-fluorophenyl)-1,4-dihydro-6,7-dimethoxy-indeno[1,2-c]pyrazol-3-amine |
|
| Molecular Formula: C18H16FN3O2 |
|
| Molecular Weight: 325.34 |
|
| Assay:98% |
|
| Appearance: Solid |
|
| SMILES:COC1=CC2=C(C=C1OC)CC3=C2NN=C3NC4=CC=CC(F)=C4 |
|
| Storage Condition: |
|
| Remark:For research use only丨JNJ-10198409 is a small molecule inhibitor of platelet-derived growth factor (PDGF-BB) tyrosine kinase with an IC50 value of 4.2 nM when tested in human coronary artery smooth muscle cells |
|
|
|
