 |
|
| Catalog No.:A1262 |
|
| Product: Etrasimod |
|
| CAS No. 1206123-37-6 |
|
| Chemical Name: (R)-2-(7-((4-cyclopentyl-3-(trifluoromethyl)benzyl)oxy)-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid |
|
| Molecular Formula: C26H26F3NO3 |
|
| Molecular Weight: 457.48 |
|
| Assay:98% |
|
| Appearance: Solid |
|
| SMILES:O=C(O)C[C@H]1CCC2=C1NC3=C2C=C(OCC4=CC=C(C5CCCC5)C(C(F)(F)F)=C4)C=C3 |
|
| Storage Condition: |
|
| Remark:For research use only丨Etrasimod is a potent, centrally available, functional antagonists of the S1P1 receptor for use as next generation therapeutics for treating multiple sclerosis (MS) and other autoimmune diseases. |
|
|
|
