Product
 | |
| Catalog No.:A1280 | |
| Product: 1400W Dihydrochloride | |
| CAS No. 180001-34-7 | |
| Chemical Name: N-[[3-(aminomethyl)phenyl]methyl]-ethanimidamide, dihydrochloride | |
| Molecular Formula: C10H17Cl2N3 | |
| Molecular Weight: 250.17 | |
| Assay:98% | |
| Appearance: Solid | |
| SMILES:CC(NCC1=CC=CC(CN)=C1)=N.[H]Cl.[H]Cl | |
| Storage Condition: | |
| Remark:For research use only.丨1400W is a highly selective inducible nitric oxide synthase inhibitor and is a potential disease modifier in the rat kainate model of temporal lobe epilepsy. | |
